C22H21NO — CID 174778237
1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine (PubChem CID 174778237) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine.
| Compound Name | 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 174778237 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine |
| SMILES | C1=CC(C2=CCOC=C2)=CCN1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H11NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-10H;1-5,7,11H,6,8H2 |
| InChIKey | ZWTNNGOXAJWPCV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |