About 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine
1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine (PubChem CID 174778237) has the molecular formula C22H21NO
and a molecular weight of 315.42 g/mol. Its IUPAC name is 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine |
| PubChem CID | 174778237 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine |
| SMILES | C1=CC(C2=CCOC=C2)=CCN1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C10H11NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-10H;1-5,7,11H,6,8H2 |
| InChIKey | ZWTNNGOXAJWPCV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine?
The IUPAC name of 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine (CID 174778237) is 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine.
What is the SMILES notation for 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine?
The canonical SMILES for 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine is C1=CC(C2=CCOC=C2)=CCN1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine?
The InChIKey is ZWTNNGOXAJWPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H11NO/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-11-6-2-9(1)10-3-7-12-8-4-10/h1-10H;1-5,7,11H,6,8H2.
What are the key properties of 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine?
1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine has a molecular weight of 315.42 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;4-(2H-pyran-4-yl)-1,2-dihydropyridine is sourced from PubChem (CID 174778237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).