C17H21NO — CID 143912430
(1E,3Z)-N-[(E)-but-2-en-2-yl]-4-methoxy-3-phenylhexa-1,3,5-trien-1-amine (PubChem CID 143912430) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (1E,3Z)-N-[(E)-but-2-en-2-yl]-4-methoxy-3-phenylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-N-[(E)-but-2-en-2-yl]-4-methoxy-3-phenylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 143912430 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (1E,3Z)-N-[(E)-but-2-en-2-yl]-4-methoxy-3-phenylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(OC)=C(\C=C\N/C(C)=C/C)c1ccccc1 |
| InChI | InChI=1S/C17H21NO/c1-5-14(3)18-13-12-16(17(6-2)19-4)15-10-8-7-9-11-15/h5-13,18H,2H2,1,3-4H3/b13-12+,14-5+,17-16- |
| InChIKey | AXSLESCTTITFBG-YCJLFCCOSA-N |
| XLogP | 4.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|