C27H39N — CID 144602395
butane;N-ethyl-2-methyl-5-[(2Z,4Z)-2-(3-methylphenyl)hepta-2,4-dien-3-yl]aniline (PubChem CID 144602395) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is butane;N-ethyl-2-methyl-5-[(2Z,4Z)-2-(3-methylphenyl)hepta-2,4-dien-3-yl]aniline.
| Compound Name | butane;N-ethyl-2-methyl-5-[(2Z,4Z)-2-(3-methylphenyl)hepta-2,4-dien-3-yl]aniline |
|---|---|
| PubChem CID | 144602395 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | butane;N-ethyl-2-methyl-5-[(2Z,4Z)-2-(3-methylphenyl)hepta-2,4-dien-3-yl]aniline |
| SMILES | CC/C=C\C(=C(/C)c1cccc(C)c1)c1ccc(C)c(NCC)c1.CCCC |
| InChI | InChI=1S/C23H29N.C4H10/c1-6-8-12-22(19(5)20-11-9-10-17(3)15-20)21-14-13-18(4)23(16-21)24-7-2;1-3-4-2/h8-16,24H,6-7H2,1-5H3;3-4H2,1-2H3/b12-8-,22-19-; |
| InChIKey | PPBJXJFDDXRWAK-HUNAVVEESA-N |
| XLogP | 8.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|