C27H36ClN — CID 144602314
butane;5-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-2-methyl-N-[(Z)-prop-1-enyl]aniline (PubChem CID 144602314) has the molecular formula C27H36ClN and a molecular weight of 410.05 g/mol. Its IUPAC name is butane;5-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-2-methyl-N-[(Z)-prop-1-enyl]aniline.
| Compound Name | butane;5-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-2-methyl-N-[(Z)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 144602314 |
| Molecular Formula | C27H36ClN |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | butane;5-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-2-methyl-N-[(Z)-prop-1-enyl]aniline |
| SMILES | C/C=C\Nc1cc(C(/C=C\CC)=C(/C)c2cccc(Cl)c2)ccc1C.CCCC |
| InChI | InChI=1S/C23H26ClN.C4H10/c1-5-7-11-22(18(4)19-9-8-10-21(24)15-19)20-13-12-17(3)23(16-20)25-14-6-2;1-3-4-2/h6-16,25H,5H2,1-4H3;3-4H2,1-2H3/b11-7-,14-6-,22-18-; |
| InChIKey | VEDSYFHGGZFXLB-WRKQNDFASA-N |
| XLogP | 9.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|