C23H26FN — CID 144602358
2-ethenyl-4-[(2Z,4Z)-2-(4-fluoro-3-methylphenyl)hepta-2,4-dien-3-yl]-N-methylaniline (PubChem CID 144602358) has the molecular formula C23H26FN and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-ethenyl-4-[(2Z,4Z)-2-(4-fluoro-3-methylphenyl)hepta-2,4-dien-3-yl]-N-methylaniline.
| Compound Name | 2-ethenyl-4-[(2Z,4Z)-2-(4-fluoro-3-methylphenyl)hepta-2,4-dien-3-yl]-N-methylaniline |
|---|---|
| PubChem CID | 144602358 |
| Molecular Formula | C23H26FN |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-ethenyl-4-[(2Z,4Z)-2-(4-fluoro-3-methylphenyl)hepta-2,4-dien-3-yl]-N-methylaniline |
| SMILES | C=Cc1cc(C(/C=C\CC)=C(/C)c2ccc(F)c(C)c2)ccc1NC |
| InChI | InChI=1S/C23H26FN/c1-6-8-9-21(17(4)19-10-12-22(24)16(3)14-19)20-11-13-23(25-5)18(7-2)15-20/h7-15,25H,2,6H2,1,3-5H3/b9-8-,21-17- |
| InChIKey | MGSONZLQYCOCJP-MIUZONMXSA-N |
| XLogP | 6.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|