C24H30 — CID 142343113
ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene (PubChem CID 142343113) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene.
| Compound Name | ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene |
|---|---|
| PubChem CID | 142343113 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene |
| SMILES | C=Cc1ccccc1-c1cc(C(/C=C\CC)=C/C)ccc1C.CC |
| InChI | InChI=1S/C22H24.C2H6/c1-5-8-11-18(6-2)20-15-14-17(4)22(16-20)21-13-10-9-12-19(21)7-3;1-2/h6-16H,3,5H2,1-2,4H3;1-2H3/b11-8-,18-6+; |
| InChIKey | HWJRZQOVRQWPKX-ASERXWTESA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|