About ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene
ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene (PubChem CID 142343113) has the molecular formula C24H30
and a molecular weight of 318.50 g/mol. Its IUPAC name is ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene.
Molecular Properties
| Compound Name | ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene |
| PubChem CID | 142343113 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene |
| SMILES | C=Cc1ccccc1-c1cc(C(/C=C\CC)=C/C)ccc1C.CC |
| InChI | InChI=1S/C22H24.C2H6/c1-5-8-11-18(6-2)20-15-14-17(4)22(16-20)21-13-10-9-12-19(21)7-3;1-2/h6-16H,3,5H2,1-2,4H3;1-2H3/b11-8-,18-6+; |
| InChIKey | HWJRZQOVRQWPKX-ASERXWTESA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene?
The IUPAC name of ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene (CID 142343113) is ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene.
What is the SMILES notation for ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene?
The canonical SMILES for ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene is C=Cc1ccccc1-c1cc(C(/C=C\CC)=C/C)ccc1C.CC.
What is the InChIKey of ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene?
The InChIKey is HWJRZQOVRQWPKX-ASERXWTESA-N. The full InChI is InChI=1S/C22H24.C2H6/c1-5-8-11-18(6-2)20-15-14-17(4)22(16-20)21-13-10-9-12-19(21)7-3;1-2/h6-16H,3,5H2,1-2,4H3;1-2H3/b11-8-,18-6+;.
What are the key properties of ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene?
ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene has a molecular weight of 318.50 g/mol, XLogP of 7.70, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-ethenylphenyl)-4-[(2E,4Z)-hepta-2,4-dien-3-yl]-1-methylbenzene is sourced from PubChem (CID 142343113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).