C35H41N2+ — CID 155691096
4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium;pent-2-ene;2-phenylpyridine (PubChem CID 155691096) has the molecular formula C35H41N2+ and a molecular weight of 489.73 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium;pent-2-ene;2-phenylpyridine.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium;pent-2-ene;2-phenylpyridine |
|---|---|
| PubChem CID | 155691096 |
| Molecular Formula | C35H41N2+ |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]-1-methyl-2-(2-methylphenyl)pyridin-1-ium;pent-2-ene;2-phenylpyridine |
| SMILES | C/C=C\C(=C/C)c1cc[n+](C)c(-c2ccccc2C)c1.CC=CCC.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C19H22N.C11H9N.C5H10/c1-5-9-16(6-2)17-12-13-20(4)19(14-17)18-11-8-7-10-15(18)3;1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-3-5-4-2/h5-14H,1-4H3;1-9H;3,5H,4H2,1-2H3/q+1;;/b9-5-,16-6+;; |
| InChIKey | BRKXWDZDSAEPFF-KVMDSIQFSA-N |
| XLogP | 9.19 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|