C38H37N4S+ — CID 142064365
(2E,4E)-N-[2-[2-(2-methyl-6-phenyl-4-pyridin-2-ylpyridin-1-ium-1-yl)ethylsulfanyl]ethyl]-1-phenyl-3-pyridin-2-ylhexa-2,4-dien-1-imine (PubChem CID 142064365) has the molecular formula C38H37N4S+ and a molecular weight of 581.81 g/mol. Its IUPAC name is (2E,4E)-N-[2-[2-(2-methyl-6-phenyl-4-pyridin-2-ylpyridin-1-ium-1-yl)ethylsulfanyl]ethyl]-1-phenyl-3-pyridin-2-ylhexa-2,4-dien-1-imine.
| Compound Name | (2E,4E)-N-[2-[2-(2-methyl-6-phenyl-4-pyridin-2-ylpyridin-1-ium-1-yl)ethylsulfanyl]ethyl]-1-phenyl-3-pyridin-2-ylhexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142064365 |
| Molecular Formula | C38H37N4S+ |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | (2E,4E)-N-[2-[2-(2-methyl-6-phenyl-4-pyridin-2-ylpyridin-1-ium-1-yl)ethylsulfanyl]ethyl]-1-phenyl-3-pyridin-2-ylhexa-2,4-dien-1-imine |
| SMILES | C/C=C/C(=C\C(=N/CCSCC[n+]1c(C)cc(-c2ccccn2)cc1-c1ccccc1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C38H37N4S/c1-3-14-33(35-19-10-12-21-39-35)28-37(31-15-6-4-7-16-31)41-23-25-43-26-24-42-30(2)27-34(36-20-11-13-22-40-36)29-38(42)32-17-8-5-9-18-32/h3-22,27-29H,23-26H2,1-2H3/q+1/b14-3+,33-28+,41-37+ |
| InChIKey | UWQIMAISLSPLIZ-QAIORFQTSA-N |
| XLogP | 8.29 |
| TPSA | 42.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|