C44H48 — CID 145264883
1-ethyl-4-[(3E,5Z)-2-[5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-propylphenyl]hepta-1,3,5-trien-4-yl]-2-(2-methyl-4-phenylphenyl)benzene (PubChem CID 145264883) has the molecular formula C44H48 and a molecular weight of 576.87 g/mol. Its IUPAC name is 1-ethyl-4-[(3E,5Z)-2-[5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-propylphenyl]hepta-1,3,5-trien-4-yl]-2-(2-methyl-4-phenylphenyl)benzene.
| Compound Name | 1-ethyl-4-[(3E,5Z)-2-[5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-propylphenyl]hepta-1,3,5-trien-4-yl]-2-(2-methyl-4-phenylphenyl)benzene |
|---|---|
| PubChem CID | 145264883 |
| Molecular Formula | C44H48 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 1-ethyl-4-[(3E,5Z)-2-[5-[(2E,4Z)-hepta-2,4-dien-3-yl]-2-propylphenyl]hepta-1,3,5-trien-4-yl]-2-(2-methyl-4-phenylphenyl)benzene |
| SMILES | C=C(/C=C(\C=C/C)c1ccc(CC)c(-c2ccc(-c3ccccc3)cc2C)c1)c1cc(C(/C=C\CC)=C/C)ccc1CCC |
| InChI | InChI=1S/C44H48/c1-8-13-19-34(11-4)40-25-23-37(17-9-2)43(30-40)33(7)29-38(18-10-3)41-24-22-35(12-5)44(31-41)42-27-26-39(28-32(42)6)36-20-15-14-16-21-36/h10-11,13-16,18-31H,7-9,12,17H2,1-6H3/b18-10-,19-13-,34-11+,38-29+ |
| InChIKey | LYBDBFAOXHDTQW-VEDDEJHUSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|