C24H31ClN2 — CID 144602273
butane;6-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-1,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 144602273) has the molecular formula C24H31ClN2 and a molecular weight of 382.98 g/mol. Its IUPAC name is butane;6-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-1,8a-dihydroimidazo[1,2-a]pyridine.
| Compound Name | butane;6-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-1,8a-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 144602273 |
| Molecular Formula | C24H31ClN2 |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | butane;6-[(2Z,4Z)-2-(3-chlorophenyl)hepta-2,4-dien-3-yl]-1,8a-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC/C=C\C(C1=CN2C=CNC2C=C1)=C(/C)c1cccc(Cl)c1.CCCC |
| InChI | InChI=1S/C20H21ClN2.C4H10/c1-3-4-8-19(15(2)16-6-5-7-18(21)13-16)17-9-10-20-22-11-12-23(20)14-17;1-3-4-2/h4-14,20,22H,3H2,1-2H3;3-4H2,1-2H3/b8-4-,19-15-; |
| InChIKey | QGTLLQQPMQRNBZ-WAUKJKKTSA-N |
| XLogP | 7.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|