C11H26N2O2 — CID 144602464
2-hydroperoxy-2-methylpropane;2-N-methylcyclohexane-1,2-diamine (PubChem CID 144602464) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;2-N-methylcyclohexane-1,2-diamine.
| Compound Name | 2-hydroperoxy-2-methylpropane;2-N-methylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 144602464 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;2-N-methylcyclohexane-1,2-diamine |
| SMILES | CC(C)(C)OO.CNC1CCCCC1N |
| InChI | InChI=1S/C7H16N2.C4H10O2/c1-9-7-5-3-2-4-6(7)8;1-4(2,3)6-5/h6-7,9H,2-5,8H2,1H3;5H,1-3H3 |
| InChIKey | APGRQWGUHGXQLX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|