C6H15N2P — CID 138625966
trans-(1R,2R)-2-N-phosphanylcyclohexane-1,2-diamine (PubChem CID 138625966) has the molecular formula C6H15N2P and a molecular weight of 146.17 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-phosphanylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-phosphanylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 138625966 |
| Molecular Formula | C6H15N2P |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.10 |
| IUPAC Name | trans-(1R,2R)-2-N-phosphanylcyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1NP |
| InChI | InChI=1S/C6H15N2P/c7-5-3-1-2-4-6(5)8-9/h5-6,8H,1-4,7,9H2/t5-,6-/m1/s1 |
| InChIKey | RXVQBVOYKQYPCU-PHDIDXHHSA-N |
| XLogP | 0.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|