C27H29ClN4O3 — CID 144603220
5-chloro-N-[1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethenyl]-1-methylpyrazole-4-carboxamide (PubChem CID 144603220) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is 5-chloro-N-[1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethenyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-[1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethenyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144603220 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 5-chloro-N-[1-[4-[(3R)-1-[4-(cyclopropylmethoxy)phenyl]pyrrolidin-3-yl]oxyphenyl]ethenyl]-1-methylpyrazole-4-carboxamide |
| SMILES | C=C(NC(=O)c1cnn(C)c1Cl)c1ccc(O[C@@H]2CCN(c3ccc(OCC4CC4)cc3)C2)cc1 |
| InChI | InChI=1S/C27H29ClN4O3/c1-18(30-27(33)25-15-29-31(2)26(25)28)20-5-9-23(10-6-20)35-24-13-14-32(16-24)21-7-11-22(12-8-21)34-17-19-3-4-19/h5-12,15,19,24H,1,3-4,13-14,16-17H2,2H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | MMTGIVQNNJNMPT-XMMPIXPASA-N |
| XLogP | 4.92 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|