C31H33N5O5 — CID 144603511
(12S)-N-[3-(benzylamino)-2,3-dioxopropyl]-12-methyl-11,14-dioxo-4,10,13-triazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide (PubChem CID 144603511) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is (12S)-N-[3-(benzylamino)-2,3-dioxopropyl]-12-methyl-11,14-dioxo-4,10,13-triazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide.
| Compound Name | (12S)-N-[3-(benzylamino)-2,3-dioxopropyl]-12-methyl-11,14-dioxo-4,10,13-triazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide |
|---|---|
| PubChem CID | 144603511 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (12S)-N-[3-(benzylamino)-2,3-dioxopropyl]-12-methyl-11,14-dioxo-4,10,13-triazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide |
| SMILES | C[C@@H]1NC(=O)CCc2cccc(c2)-c2cncc(c2)CCC(C(=O)NCC(=O)C(=O)NCc2ccccc2)NC1=O |
| InChI | InChI=1S/C31H33N5O5/c1-20-29(39)36-26(30(40)34-19-27(37)31(41)33-17-22-6-3-2-4-7-22)12-10-23-15-25(18-32-16-23)24-9-5-8-21(14-24)11-13-28(38)35-20/h2-9,14-16,18,20,26H,10-13,17,19H2,1H3,(H,33,41)(H,34,40)(H,35,38)(H,36,39)/t20-,26?/m0/s1 |
| InChIKey | PFBJGISZSCGECJ-DQUNLGLBSA-N |
| XLogP | 1.62 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|