C26H30N4O5 — CID 123139360
12-methyl-N-[3-(methylamino)-2,3-dioxopropyl]-11,14-dioxo-10,13-diazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide (PubChem CID 123139360) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is 12-methyl-N-[3-(methylamino)-2,3-dioxopropyl]-11,14-dioxo-10,13-diazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide.
| Compound Name | 12-methyl-N-[3-(methylamino)-2,3-dioxopropyl]-11,14-dioxo-10,13-diazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide |
|---|---|
| PubChem CID | 123139360 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 12-methyl-N-[3-(methylamino)-2,3-dioxopropyl]-11,14-dioxo-10,13-diazatricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-9-carboxamide |
| SMILES | CNC(=O)C(=O)CNC(=O)C1CCc2cccc(c2)-c2cccc(c2)CCC(=O)NC(C)C(=O)N1 |
| InChI | InChI=1S/C26H30N4O5/c1-16-24(33)30-21(25(34)28-15-22(31)26(35)27-2)11-9-17-5-3-7-19(13-17)20-8-4-6-18(14-20)10-12-23(32)29-16/h3-8,13-14,16,21H,9-12,15H2,1-2H3,(H,27,35)(H,28,34)(H,29,32)(H,30,33) |
| InChIKey | FDMSKZPBBJNQCH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|