C20H21ClF5N3O — CID 144603710
(2Z)-2-(1-chloroethenyl)-N-[2-(4,4-difluoropiperidin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]penta-2,4-dienamide (PubChem CID 144603710) has the molecular formula C20H21ClF5N3O and a molecular weight of 449.85 g/mol. Its IUPAC name is (2Z)-2-(1-chloroethenyl)-N-[2-(4,4-difluoropiperidin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]penta-2,4-dienamide.
| Compound Name | (2Z)-2-(1-chloroethenyl)-N-[2-(4,4-difluoropiperidin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 144603710 |
| Molecular Formula | C20H21ClF5N3O |
| Molecular Weight | 449.85 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | (2Z)-2-(1-chloroethenyl)-N-[2-(4,4-difluoropiperidin-1-yl)-2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C(=C)Cl)C(=O)NCC(c1ccc(C(F)(F)F)nc1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C20H21ClF5N3O/c1-3-4-15(13(2)21)18(30)28-12-16(29-9-7-19(22,23)8-10-29)14-5-6-17(27-11-14)20(24,25)26/h3-6,11,16H,1-2,7-10,12H2,(H,28,30)/b15-4+ |
| InChIKey | YVTSHGVBROCGNQ-SYZQJQIISA-N |
| XLogP | 4.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|