C17H21F2NO — CID 144605377
3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde (PubChem CID 144605377) has the molecular formula C17H21F2NO and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde.
| Compound Name | 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 144605377 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde |
| SMILES | O=Cc1cccc(CC2CC2NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C17H21F2NO/c18-17(19)6-4-15(5-7-17)20-16-10-14(16)9-12-2-1-3-13(8-12)11-21/h1-3,8,11,14-16,20H,4-7,9-10H2 |
| InChIKey | VZEHHFGLTFAFEN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|