About 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde
3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde (PubChem CID 144605377) has the molecular formula C17H21F2NO
and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde |
| PubChem CID | 144605377 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde |
| SMILES | O=Cc1cccc(CC2CC2NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C17H21F2NO/c18-17(19)6-4-15(5-7-17)20-16-10-14(16)9-12-2-1-3-13(8-12)11-21/h1-3,8,11,14-16,20H,4-7,9-10H2 |
| InChIKey | VZEHHFGLTFAFEN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde?
The IUPAC name of 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde (CID 144605377) is 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde.
What is the SMILES notation for 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde?
The canonical SMILES for 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde is O=Cc1cccc(CC2CC2NC2CCC(F)(F)CC2)c1.
What is the InChIKey of 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde?
The InChIKey is VZEHHFGLTFAFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2NO/c18-17(19)6-4-15(5-7-17)20-16-10-14(16)9-12-2-1-3-13(8-12)11-21/h1-3,8,11,14-16,20H,4-7,9-10H2.
What are the key properties of 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde?
3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde has a molecular weight of 293.36 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]methyl]benzaldehyde is sourced from PubChem (CID 144605377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).