C22H32F2N2O2 — CID 144605469
3-[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]benzaldehyde;N-methyloxan-4-amine (PubChem CID 144605469) has the molecular formula C22H32F2N2O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 3-[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]benzaldehyde;N-methyloxan-4-amine.
| Compound Name | 3-[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]benzaldehyde;N-methyloxan-4-amine |
|---|---|
| PubChem CID | 144605469 |
| Molecular Formula | C22H32F2N2O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 3-[2-[(4,4-difluorocyclohexyl)amino]cyclopropyl]benzaldehyde;N-methyloxan-4-amine |
| SMILES | CNC1CCOCC1.O=Cc1cccc(C2CC2NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C16H19F2NO.C6H13NO/c17-16(18)6-4-13(5-7-16)19-15-9-14(15)12-3-1-2-11(8-12)10-20;1-7-6-2-4-8-5-3-6/h1-3,8,10,13-15,19H,4-7,9H2;6-7H,2-5H2,1H3 |
| InChIKey | CLRBRDXUVNAVRC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|