C18H34N2O2 — CID 144605941
1-(3,3-dimethylbutanoyl)-N-[(E)-2-methylbut-2-enyl]pyrrolidine-2-carboxamide;ethane (PubChem CID 144605941) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-(3,3-dimethylbutanoyl)-N-[(E)-2-methylbut-2-enyl]pyrrolidine-2-carboxamide;ethane.
| Compound Name | 1-(3,3-dimethylbutanoyl)-N-[(E)-2-methylbut-2-enyl]pyrrolidine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144605941 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 1-(3,3-dimethylbutanoyl)-N-[(E)-2-methylbut-2-enyl]pyrrolidine-2-carboxamide;ethane |
| SMILES | C/C=C(\C)CNC(=O)C1CCCN1C(=O)CC(C)(C)C.CC |
| InChI | InChI=1S/C16H28N2O2.C2H6/c1-6-12(2)11-17-15(20)13-8-7-9-18(13)14(19)10-16(3,4)5;1-2/h6,13H,7-11H2,1-5H3,(H,17,20);1-2H3/b12-6+; |
| InChIKey | FOAZHHNWKPBDMJ-WXIWBVQFSA-N |
| XLogP | 3.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|