C22H17ClF3N5O3 — CID 144606017
(2Z,4Z)-4-[[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]methyl]-2-cyano-N-methylhepta-2,4-dienamide (PubChem CID 144606017) has the molecular formula C22H17ClF3N5O3 and a molecular weight of 491.86 g/mol. Its IUPAC name is (2Z,4Z)-4-[[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]methyl]-2-cyano-N-methylhepta-2,4-dienamide.
| Compound Name | (2Z,4Z)-4-[[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]methyl]-2-cyano-N-methylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 144606017 |
| Molecular Formula | C22H17ClF3N5O3 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (2Z,4Z)-4-[[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]methyl]-2-cyano-N-methylhepta-2,4-dienamide |
| SMILES | CC/C=C(/C=C(/C#N)C(=O)NC)Cn1cnc(C(F)(F)F)c(Oc2cc(Cl)cc(C#N)c2)c1=O |
| InChI | InChI=1S/C22H17ClF3N5O3/c1-3-4-13(5-15(10-28)20(32)29-2)11-31-12-30-19(22(24,25)26)18(21(31)33)34-17-7-14(9-27)6-16(23)8-17/h4-8,12H,3,11H2,1-2H3,(H,29,32)/b13-4-,15-5- |
| InChIKey | ZKUIWDUMOAIVTI-GJVKEOEBSA-N |
| XLogP | 4.11 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|