C21H18ClF4N5O3 — CID 166980060
3-chloro-5-[4-(1,1-difluoroethyl)-1-[(Z)-5,5-difluoro-2-formyl-4-(methylhydrazinylidene)hex-2-enyl]-6-oxopyrimidin-5-yl]oxybenzonitrile (PubChem CID 166980060) has the molecular formula C21H18ClF4N5O3 and a molecular weight of 499.85 g/mol. Its IUPAC name is 3-chloro-5-[4-(1,1-difluoroethyl)-1-[(Z)-5,5-difluoro-2-formyl-4-(methylhydrazinylidene)hex-2-enyl]-6-oxopyrimidin-5-yl]oxybenzonitrile.
| Compound Name | 3-chloro-5-[4-(1,1-difluoroethyl)-1-[(Z)-5,5-difluoro-2-formyl-4-(methylhydrazinylidene)hex-2-enyl]-6-oxopyrimidin-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 166980060 |
| Molecular Formula | C21H18ClF4N5O3 |
| Molecular Weight | 499.85 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 3-chloro-5-[4-(1,1-difluoroethyl)-1-[(Z)-5,5-difluoro-2-formyl-4-(methylhydrazinylidene)hex-2-enyl]-6-oxopyrimidin-5-yl]oxybenzonitrile |
| SMILES | CNN=C(/C=C(\C=O)Cn1cnc(C(C)(F)F)c(Oc2cc(Cl)cc(C#N)c2)c1=O)C(C)(F)F |
| InChI | InChI=1S/C21H18ClF4N5O3/c1-20(23,24)16(30-28-3)6-13(10-32)9-31-11-29-18(21(2,25)26)17(19(31)33)34-15-5-12(8-27)4-14(22)7-15/h4-7,10-11,28H,9H2,1-3H3/b13-6-,30-16? |
| InChIKey | IZKMKWHJBXRVRL-HVCFUOFNSA-N |
| XLogP | 4.03 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|