C23H16ClF3N6O3 — CID 130436033
N-[(E)-[(E)-4-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-3-methyl-1-pyridin-3-ylbut-2-enylidene]amino]formamide (PubChem CID 130436033) has the molecular formula C23H16ClF3N6O3 and a molecular weight of 516.87 g/mol. Its IUPAC name is N-[(E)-[(E)-4-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-3-methyl-1-pyridin-3-ylbut-2-enylidene]amino]formamide.
| Compound Name | N-[(E)-[(E)-4-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-3-methyl-1-pyridin-3-ylbut-2-enylidene]amino]formamide |
|---|---|
| PubChem CID | 130436033 |
| Molecular Formula | C23H16ClF3N6O3 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | N-[(E)-[(E)-4-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-3-methyl-1-pyridin-3-ylbut-2-enylidene]amino]formamide |
| SMILES | C/C(=C\C(=N/NC=O)c1cccnc1)Cn1cnc(C(F)(F)F)c(Oc2cc(Cl)cc(C#N)c2)c1=O |
| InChI | InChI=1S/C23H16ClF3N6O3/c1-14(5-19(32-31-13-34)16-3-2-4-29-10-16)11-33-12-30-21(23(25,26)27)20(22(33)35)36-18-7-15(9-28)6-17(24)8-18/h2-8,10,12-13H,11H2,1H3,(H,31,34)/b14-5+,32-19+ |
| InChIKey | IQRPYBDCKZCPMG-SATSYELGSA-N |
| XLogP | 4.07 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|