C24H18ClF3N6O4 — CID 146621993
N-[(E)-[(E)-1-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-(6-methoxy-3-pyridinyl)pent-3-en-2-ylidene]amino]formamide (PubChem CID 146621993) has the molecular formula C24H18ClF3N6O4 and a molecular weight of 546.89 g/mol. Its IUPAC name is N-[(E)-[(E)-1-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-(6-methoxy-3-pyridinyl)pent-3-en-2-ylidene]amino]formamide.
| Compound Name | N-[(E)-[(E)-1-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-(6-methoxy-3-pyridinyl)pent-3-en-2-ylidene]amino]formamide |
|---|---|
| PubChem CID | 146621993 |
| Molecular Formula | C24H18ClF3N6O4 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | N-[(E)-[(E)-1-[5-(3-chloro-5-cyanophenoxy)-6-oxo-4-(trifluoromethyl)pyrimidin-1-yl]-4-(6-methoxy-3-pyridinyl)pent-3-en-2-ylidene]amino]formamide |
| SMILES | COc1ccc(/C(C)=C/C(Cn2cnc(C(F)(F)F)c(Oc3cc(Cl)cc(C#N)c3)c2=O)=N\NC=O)cn1 |
| InChI | InChI=1S/C24H18ClF3N6O4/c1-14(16-3-4-20(37-2)30-10-16)5-18(33-32-13-35)11-34-12-31-22(24(26,27)28)21(23(34)36)38-19-7-15(9-29)6-17(25)8-19/h3-8,10,12-13H,11H2,1-2H3,(H,32,35)/b14-5+,33-18+ |
| InChIKey | ZCPYZYBOTRLTPO-MLAFYGGZSA-N |
| XLogP | 4.19 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|