C23H22ClF3N4O4 — CID 123814223
3-chloro-5-[1-[5-hydroxy-2-[methoxy-(2-methylaziridin-1-yl)methylidene]-4-methylpent-3-enyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile (PubChem CID 123814223) has the molecular formula C23H22ClF3N4O4 and a molecular weight of 510.90 g/mol. Its IUPAC name is 3-chloro-5-[1-[5-hydroxy-2-[methoxy-(2-methylaziridin-1-yl)methylidene]-4-methylpent-3-enyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile.
| Compound Name | 3-chloro-5-[1-[5-hydroxy-2-[methoxy-(2-methylaziridin-1-yl)methylidene]-4-methylpent-3-enyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 123814223 |
| Molecular Formula | C23H22ClF3N4O4 |
| Molecular Weight | 510.90 g/mol |
| Exact Mass | 510.13 |
| IUPAC Name | 3-chloro-5-[1-[5-hydroxy-2-[methoxy-(2-methylaziridin-1-yl)methylidene]-4-methylpent-3-enyl]-6-oxo-4-(trifluoromethyl)pyrimidin-5-yl]oxybenzonitrile |
| SMILES | COC(=C(C=C(C)CO)Cn1cnc(C(F)(F)F)c(Oc2cc(Cl)cc(C#N)c2)c1=O)N1CC1C |
| InChI | InChI=1S/C23H22ClF3N4O4/c1-13(11-32)4-16(22(34-3)31-9-14(31)2)10-30-12-29-20(23(25,26)27)19(21(30)33)35-18-6-15(8-28)5-17(24)7-18/h4-7,12,14,32H,9-11H2,1-3H3 |
| InChIKey | BDGFQJQOELKNJM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|