C23H29ClOS — CID 144607670
(6-tert-butyl-5-methoxy-2-methyl-4-phenyl-3H-inden-1-yl)-chloro-dimethyl-λ4-sulfane (PubChem CID 144607670) has the molecular formula C23H29ClOS and a molecular weight of 389.00 g/mol. Its IUPAC name is (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-3H-inden-1-yl)-chloro-dimethyl-λ4-sulfane.
| Compound Name | (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-3H-inden-1-yl)-chloro-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 144607670 |
| Molecular Formula | C23H29ClOS |
| Molecular Weight | 389.00 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-3H-inden-1-yl)-chloro-dimethyl-λ4-sulfane |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1ccccc1)CC(C)=C2S(C)(C)Cl |
| InChI | InChI=1S/C23H29ClOS/c1-15-13-17-18(22(15)26(6,7)24)14-19(23(2,3)4)21(25-5)20(17)16-11-9-8-10-12-16/h8-12,14H,13H2,1-7H3 |
| InChIKey | TYQUUGIITBLQFT-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.00 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |