C23H29ClOSi — CID 71231037
(6-tert-butyl-5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-chloro-dimethylsilane (PubChem CID 71231037) has the molecular formula C23H29ClOSi and a molecular weight of 385.02 g/mol. Its IUPAC name is (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-chloro-dimethylsilane.
| Compound Name | (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-chloro-dimethylsilane |
|---|---|
| PubChem CID | 71231037 |
| Molecular Formula | C23H29ClOSi |
| Molecular Weight | 385.02 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (6-tert-butyl-5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-chloro-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1ccccc1)C=C(C)C2[Si](C)(C)Cl |
| InChI | InChI=1S/C23H29ClOSi/c1-15-13-17-18(22(15)26(6,7)24)14-19(23(2,3)4)21(25-5)20(17)16-11-9-8-10-12-16/h8-14,22H,1-7H3 |
| InChIKey | VFUJLECROWNZMH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.02 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|