C60H82ClO2Si — CID 174186069
CID 174186069 (PubChem CID 174186069) has the molecular formula C60H82ClO2Si and a molecular weight of 898.85 g/mol.
| Compound Name | CID 174186069 |
|---|---|
| PubChem CID | 174186069 |
| Molecular Formula | C60H82ClO2Si |
| Molecular Weight | 898.85 g/mol |
| Exact Mass | 897.58 |
| IUPAC Name | — |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1)C=C(C)C2C[Si](Cl)CC1C(C)=Cc2c1cc(C(C)(C)C)c(OC)c2-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C60H82ClO2Si/c1-35-23-45-43(31-49(59(15,16)17)53(62-21)51(45)37-25-39(55(3,4)5)29-40(26-37)56(6,7)8)47(35)33-64(61)34-48-36(2)24-46-44(48)32-50(60(18,19)20)54(63-22)52(46)38-27-41(57(9,10)11)30-42(28-38)58(12,13)14/h23-32,47-48H,33-34H2,1-22H3 |
| InChIKey | FPGIBIILMLZODT-UHFFFAOYSA-N |
| XLogP | 17.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.85 |
| LogP ≤ 5 | 17.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|