C41H58OSi — CID 178126142
[4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]inden-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 178126142) has the molecular formula C41H58OSi and a molecular weight of 595.00 g/mol. Its IUPAC name is [4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]inden-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | [4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]inden-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 178126142 |
| Molecular Formula | C41H58OSi |
| Molecular Weight | 595.00 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | [4-(3,5-ditert-butyl-4-methoxyphenyl)-2-methyl-1,5,6,7,8,9-hexahydrocyclohepta[f]inden-1-yl]-dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | COc1c(C(C)(C)C)cc(-c2c3c(cc4c2CCCCC4)C([Si](C)(C)C2C(C)=C(C)C(C)=C2C)C(C)=C3)cc1C(C)(C)C |
| InChI | InChI=1S/C41H58OSi/c1-24-20-32-33(38(24)43(13,14)39-27(4)25(2)26(3)28(39)5)21-29-18-16-15-17-19-31(29)36(32)30-22-34(40(6,7)8)37(42-12)35(23-30)41(9,10)11/h20-23,38-39H,15-19H2,1-14H3 |
| InChIKey | PYKRIKAMIDYDHA-UHFFFAOYSA-N |
| XLogP | 12.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.00 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|