C46H54OSi — CID 153321039
[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane (PubChem CID 153321039) has the molecular formula C46H54OSi and a molecular weight of 651.02 g/mol. Its IUPAC name is [6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane.
| Compound Name | [6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 153321039 |
| Molecular Formula | C46H54OSi |
| Molecular Weight | 651.02 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | [6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-[4-(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1cc(C)cc(C)c1)C=C(C)C2[Si](C)(C)C1C(C)=Cc2c1cc1c(c2-c2cc(C)cc(C)c2)CCC1 |
| InChI | InChI=1S/C46H54OSi/c1-26-16-27(2)19-33(18-26)41-35-15-13-14-32(35)24-38-36(41)22-30(5)44(38)48(11,12)45-31(6)23-37-39(45)25-40(46(7,8)9)43(47-10)42(37)34-20-28(3)17-29(4)21-34/h16-25,44-45H,13-15H2,1-12H3 |
| InChIKey | LKFGGFGLOYRWTP-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.02 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|