C54H62OS — CID 167284148
[4,8-bis(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-dimethyl-λ4-sulfane (PubChem CID 167284148) has the molecular formula C54H62OS and a molecular weight of 759.16 g/mol. Its IUPAC name is [4,8-bis(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-dimethyl-λ4-sulfane.
| Compound Name | [4,8-bis(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-dimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 167284148 |
| Molecular Formula | C54H62OS |
| Molecular Weight | 759.16 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | [4,8-bis(3,5-dimethylphenyl)-2-methyl-1,5,6,7-tetrahydro-s-indacen-1-yl]-[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-1H-inden-1-yl]-dimethyl-λ4-sulfane |
| SMILES | COc1c(C(C)(C)C)cc2c(c1-c1cc(C)cc(C)c1)C=C(C)C2S(C)(C)C1C(C)=Cc2c(-c3cc(C)cc(C)c3)c3c(c(-c4cc(C)cc(C)c4)c21)CCC3 |
| InChI | InChI=1S/C54H62OS/c1-30-18-31(2)22-38(21-30)47-41-16-15-17-42(41)48(39-23-32(3)19-33(4)24-39)50-45(47)28-37(8)53(50)56(13,14)52-36(7)27-43-44(52)29-46(54(9,10)11)51(55-12)49(43)40-25-34(5)20-35(6)26-40/h18-29,52-53H,15-17H2,1-14H3 |
| InChIKey | DSZFAGRIABKZBR-UHFFFAOYSA-N |
| XLogP | 15.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.16 |
| LogP ≤ 5 | 15.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |