C19H21ClOSi — CID 90243386
chloro-(5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-dimethylsilane (PubChem CID 90243386) has the molecular formula C19H21ClOSi and a molecular weight of 328.92 g/mol. Its IUPAC name is chloro-(5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-dimethylsilane.
| Compound Name | chloro-(5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 90243386 |
| Molecular Formula | C19H21ClOSi |
| Molecular Weight | 328.92 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | chloro-(5-methoxy-2-methyl-4-phenyl-1H-inden-1-yl)-dimethylsilane |
| SMILES | COc1ccc2c(c1-c1ccccc1)C=C(C)C2[Si](C)(C)Cl |
| InChI | InChI=1S/C19H21ClOSi/c1-13-12-16-15(19(13)22(3,4)20)10-11-17(21-2)18(16)14-8-6-5-7-9-14/h5-12,19H,1-4H3 |
| InChIKey | OWKYXCHMWWKVET-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|