C44H34N4Pt — CID 144608371
[(2Z,4Z,7E,11E,14Z,16Z)-16-azanidyl-2,7,12,17-tetraphenyl-21,22-diazanidatricyclo[16.2.1.18,11]docosa-1(20),2,4,7,9,11,14,16,18-nonaen-3-yl]azanide;platinum(4+) (PubChem CID 144608371) has the molecular formula C44H34N4Pt and a molecular weight of 813.86 g/mol. Its IUPAC name is [(2Z,4Z,7E,11E,14Z,16Z)-16-azanidyl-2,7,12,17-tetraphenyl-21,22-diazanidatricyclo[16.2.1.18,11]docosa-1(20),2,4,7,9,11,14,16,18-nonaen-3-yl]azanide;platinum(4+).
| Compound Name | [(2Z,4Z,7E,11E,14Z,16Z)-16-azanidyl-2,7,12,17-tetraphenyl-21,22-diazanidatricyclo[16.2.1.18,11]docosa-1(20),2,4,7,9,11,14,16,18-nonaen-3-yl]azanide;platinum(4+) |
|---|---|
| PubChem CID | 144608371 |
| Molecular Formula | C44H34N4Pt |
| Molecular Weight | 813.86 g/mol |
| Exact Mass | 813.24 |
| IUPAC Name | [(2Z,4Z,7E,11E,14Z,16Z)-16-azanidyl-2,7,12,17-tetraphenyl-21,22-diazanidatricyclo[16.2.1.18,11]docosa-1(20),2,4,7,9,11,14,16,18-nonaen-3-yl]azanide;platinum(4+) |
| SMILES | [NH-]C1=C(/c2ccccc2)c2ccc([n-]2)/C(c2ccccc2)=C([NH-])/C=C\C/C(c2ccccc2)=c2/cc/c([n-]2)=C(\c2ccccc2)C/C=C\1.[Pt+4] |
| InChI | InChI=1S/C44H34N4.Pt/c45-37-25-13-23-35(31-15-5-1-6-16-31)39-27-28-40(47-39)36(32-17-7-2-8-18-32)24-14-26-38(46)44(34-21-11-4-12-22-34)42-30-29-41(48-42)43(37)33-19-9-3-10-20-33;/h1-22,25-30,45-46H,23-24H2;/q-4;+4/b25-13-,26-14-,39-35+,40-36+,43-37-,44-38-; |
| InChIKey | BUYRWHLDVNRORZ-RMHHUWPCSA-N |
| XLogP | 9.23 |
| TPSA | 75.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.86 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |