C28H40N2O5 — CID 144610546
methyl 5-[2-[1-(dihydroxymethyl)piperidin-4-yl]ethynyl]-2-methyl-3-[2-[(1R)-2-methylcyclopropyl]ethyl-(oxan-4-yl)amino]benzoate (PubChem CID 144610546) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is methyl 5-[2-[1-(dihydroxymethyl)piperidin-4-yl]ethynyl]-2-methyl-3-[2-[(1R)-2-methylcyclopropyl]ethyl-(oxan-4-yl)amino]benzoate.
| Compound Name | methyl 5-[2-[1-(dihydroxymethyl)piperidin-4-yl]ethynyl]-2-methyl-3-[2-[(1R)-2-methylcyclopropyl]ethyl-(oxan-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 144610546 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | methyl 5-[2-[1-(dihydroxymethyl)piperidin-4-yl]ethynyl]-2-methyl-3-[2-[(1R)-2-methylcyclopropyl]ethyl-(oxan-4-yl)amino]benzoate |
| SMILES | COC(=O)c1cc(C#CC2CCN(C(O)O)CC2)cc(N(CC[C@H]2CC2C)C2CCOCC2)c1C |
| InChI | InChI=1S/C28H40N2O5/c1-19-16-23(19)8-13-30(24-9-14-35-15-10-24)26-18-22(17-25(20(26)2)27(31)34-3)5-4-21-6-11-29(12-7-21)28(32)33/h17-19,21,23-24,28,32-33H,6-16H2,1-3H3/t19?,23-/m0/s1 |
| InChIKey | APRRJNYZKKCDEQ-BVHINDKJSA-N |
| XLogP | 3.14 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|