C28H40N2O3 — CID 155215829
3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]ethynyl]benzaldehyde (PubChem CID 155215829) has the molecular formula C28H40N2O3 and a molecular weight of 452.64 g/mol. Its IUPAC name is 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]ethynyl]benzaldehyde.
| Compound Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]ethynyl]benzaldehyde |
|---|---|
| PubChem CID | 155215829 |
| Molecular Formula | C28H40N2O3 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 3-[ethyl(oxan-4-yl)amino]-2-methyl-5-[2-[1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]piperidin-4-yl]ethynyl]benzaldehyde |
| SMILES | C=C(OC(C)(C)C)N1CCC(C#Cc2cc(C=O)c(C)c(N(CC)C3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C28H40N2O3/c1-7-30(26-12-16-32-17-13-26)27-19-24(18-25(20-31)21(27)2)9-8-23-10-14-29(15-11-23)22(3)33-28(4,5)6/h18-20,23,26H,3,7,10-17H2,1-2,4-6H3 |
| InChIKey | MRADBZXQDRLPFI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|