C28H48 — CID 144611644
1,2,4a,8,8,10b-hexamethyl-7-(2-methylpropyl)-2,3,4,4b,5,7,9,10,10a,11,12,12a-dodecahydro-1H-chrysene (PubChem CID 144611644) has the molecular formula C28H48 and a molecular weight of 384.69 g/mol. Its IUPAC name is 1,2,4a,8,8,10b-hexamethyl-7-(2-methylpropyl)-2,3,4,4b,5,7,9,10,10a,11,12,12a-dodecahydro-1H-chrysene.
| Compound Name | 1,2,4a,8,8,10b-hexamethyl-7-(2-methylpropyl)-2,3,4,4b,5,7,9,10,10a,11,12,12a-dodecahydro-1H-chrysene |
|---|---|
| PubChem CID | 144611644 |
| Molecular Formula | C28H48 |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.38 |
| IUPAC Name | 1,2,4a,8,8,10b-hexamethyl-7-(2-methylpropyl)-2,3,4,4b,5,7,9,10,10a,11,12,12a-dodecahydro-1H-chrysene |
| SMILES | CC(C)CC1C2=CCC3C(C)(CCC4C(C)C(C)CCC43C)C2CCC1(C)C |
| InChI | InChI=1S/C28H48/c1-18(2)17-24-21-9-10-25-27(7)15-11-19(3)20(4)22(27)13-16-28(25,8)23(21)12-14-26(24,5)6/h9,18-20,22-25H,10-17H2,1-8H3 |
| InChIKey | XSDWPUIOIUUCSM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|