C35H59NO6 — CID 145092703
[8a-(dimethylcarbamoyl)-4,6a,12,14b-tetramethyl-2,3,4,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-picen-3-yl] 3-hydroxy-4-oxobutanoate;methane;methanol (PubChem CID 145092703) has the molecular formula C35H59NO6 and a molecular weight of 589.86 g/mol. Its IUPAC name is [8a-(dimethylcarbamoyl)-4,6a,12,14b-tetramethyl-2,3,4,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-picen-3-yl] 3-hydroxy-4-oxobutanoate;methane;methanol.
| Compound Name | [8a-(dimethylcarbamoyl)-4,6a,12,14b-tetramethyl-2,3,4,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-picen-3-yl] 3-hydroxy-4-oxobutanoate;methane;methanol |
|---|---|
| PubChem CID | 145092703 |
| Molecular Formula | C35H59NO6 |
| Molecular Weight | 589.86 g/mol |
| Exact Mass | 589.43 |
| IUPAC Name | [8a-(dimethylcarbamoyl)-4,6a,12,14b-tetramethyl-2,3,4,4a,5,6,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-picen-3-yl] 3-hydroxy-4-oxobutanoate;methane;methanol |
| SMILES | C.CC1CCCC2(C(=O)N(C)C)CCC3C(=CCC4C3(C)CCC3C(C)C(OC(=O)CC(O)C=O)CCC34C)C12.CO |
| InChI | InChI=1S/C33H51NO5.CH4O.CH4/c1-20-8-7-14-33(30(38)34(5)6)17-12-25-23(29(20)33)9-10-27-31(3)16-13-26(39-28(37)18-22(36)19-35)21(2)24(31)11-15-32(25,27)4;1-2;/h9,19-22,24-27,29,36H,7-8,10-18H2,1-6H3;2H,1H3;1H4 |
| InChIKey | HQTFUDQJSABQSI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.86 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|