C17H26OS2 — CID 144619543
2-[2-[(S)-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfinyl]sulfanylpropan-2-yl]cyclohexa-1,3-diene (PubChem CID 144619543) has the molecular formula C17H26OS2 and a molecular weight of 310.53 g/mol. Its IUPAC name is 2-[2-[(S)-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfinyl]sulfanylpropan-2-yl]cyclohexa-1,3-diene.
| Compound Name | 2-[2-[(S)-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfinyl]sulfanylpropan-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144619543 |
| Molecular Formula | C17H26OS2 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[2-[(S)-[(3E,5Z)-3-methylhepta-3,5-dien-2-yl]sulfinyl]sulfanylpropan-2-yl]cyclohexa-1,3-diene |
| SMILES | C/C=C\C=C(/C)C(C)[S@@](=O)SC(C)(C)C1=CCCC=C1 |
| InChI | InChI=1S/C17H26OS2/c1-6-7-11-14(2)15(3)20(18)19-17(4,5)16-12-9-8-10-13-16/h6-7,9,11-13,15H,8,10H2,1-5H3/b7-6-,14-11+/t15?,20-/m0/s1 |
| InChIKey | QMMZQHBBMQZCAO-VNBFFRPYSA-N |
| XLogP | 5.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|