C35H38F3N5O2S — CID 144619922
ethylbenzene;1-[4-[5-(methylamino)-2-pyridinyl]-1-pent-4-enylimidazol-2-yl]-1-[3-(trifluoromethyl)phenyl]ethanol;1,3-thiazole-4-carbaldehyde (PubChem CID 144619922) has the molecular formula C35H38F3N5O2S and a molecular weight of 649.78 g/mol. Its IUPAC name is ethylbenzene;1-[4-[5-(methylamino)-2-pyridinyl]-1-pent-4-enylimidazol-2-yl]-1-[3-(trifluoromethyl)phenyl]ethanol;1,3-thiazole-4-carbaldehyde.
| Compound Name | ethylbenzene;1-[4-[5-(methylamino)-2-pyridinyl]-1-pent-4-enylimidazol-2-yl]-1-[3-(trifluoromethyl)phenyl]ethanol;1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 144619922 |
| Molecular Formula | C35H38F3N5O2S |
| Molecular Weight | 649.78 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | ethylbenzene;1-[4-[5-(methylamino)-2-pyridinyl]-1-pent-4-enylimidazol-2-yl]-1-[3-(trifluoromethyl)phenyl]ethanol;1,3-thiazole-4-carbaldehyde |
| SMILES | C=CCCCn1cc(-c2ccc(NC)cn2)nc1C(C)(O)c1cccc(C(F)(F)F)c1.CCc1ccccc1.O=Cc1cscn1 |
| InChI | InChI=1S/C23H25F3N4O.C8H10.C4H3NOS/c1-4-5-6-12-30-15-20(19-11-10-18(27-3)14-28-19)29-21(30)22(2,31)16-8-7-9-17(13-16)23(24,25)26;1-2-8-6-4-3-5-7-8;6-1-4-2-7-3-5-4/h4,7-11,13-15,27,31H,1,5-6,12H2,2-3H3;3-7H,2H2,1H3;1-3H |
| InChIKey | GTRJIACUDOSLTQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.78 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|