C17H14N2O3S — CID 144621161
N-(1-benzofuran-5-yl)-4-(1-oxothiazetidin-2-yl)benzamide (PubChem CID 144621161) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-(1-benzofuran-5-yl)-4-(1-oxothiazetidin-2-yl)benzamide.
| Compound Name | N-(1-benzofuran-5-yl)-4-(1-oxothiazetidin-2-yl)benzamide |
|---|---|
| PubChem CID | 144621161 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(1-benzofuran-5-yl)-4-(1-oxothiazetidin-2-yl)benzamide |
| SMILES | O=C(Nc1ccc2occc2c1)c1ccc(N2CCS2=O)cc1 |
| InChI | InChI=1S/C17H14N2O3S/c20-17(18-14-3-6-16-13(11-14)7-9-22-16)12-1-4-15(5-2-12)19-8-10-23(19)21/h1-7,9,11H,8,10H2,(H,18,20) |
| InChIKey | HNVNAZWBQHGPQI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |