C14H20FNO — CID 144622050
1-[3-[(3E)-4-fluoro-2-methylidenehexa-3,5-dienyl]piperidin-1-yl]ethanone (PubChem CID 144622050) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-[3-[(3E)-4-fluoro-2-methylidenehexa-3,5-dienyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[(3E)-4-fluoro-2-methylidenehexa-3,5-dienyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 144622050 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[3-[(3E)-4-fluoro-2-methylidenehexa-3,5-dienyl]piperidin-1-yl]ethanone |
| SMILES | C=C/C(F)=C\C(=C)CC1CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C14H20FNO/c1-4-14(15)9-11(2)8-13-6-5-7-16(10-13)12(3)17/h4,9,13H,1-2,5-8,10H2,3H3/b14-9+ |
| InChIKey | OXEZNMIRIVTPJP-NTEUORMPSA-N |
| XLogP | 3.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|