C19H30FNO — CID 143900181
(Z)-5-ethyl-2-[(1E)-1-fluorobuta-1,3-dienyl]-1-piperidin-1-yloct-2-en-1-one (PubChem CID 143900181) has the molecular formula C19H30FNO and a molecular weight of 307.45 g/mol. Its IUPAC name is (Z)-5-ethyl-2-[(1E)-1-fluorobuta-1,3-dienyl]-1-piperidin-1-yloct-2-en-1-one.
| Compound Name | (Z)-5-ethyl-2-[(1E)-1-fluorobuta-1,3-dienyl]-1-piperidin-1-yloct-2-en-1-one |
|---|---|
| PubChem CID | 143900181 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (Z)-5-ethyl-2-[(1E)-1-fluorobuta-1,3-dienyl]-1-piperidin-1-yloct-2-en-1-one |
| SMILES | C=C/C=C(F)\C(=C/CC(CC)CCC)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H30FNO/c1-4-10-16(6-3)12-13-17(18(20)11-5-2)19(22)21-14-8-7-9-15-21/h5,11,13,16H,2,4,6-10,12,14-15H2,1,3H3/b17-13+,18-11+ |
| InChIKey | IUWQVUBNSBAVDP-IOZDLPHISA-N |
| XLogP | 5.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|