C25H44FNO — CID 130216715
(2E,4E)-2-butan-2-yl-1-(4-butan-2-yl-4-fluoropiperidin-1-yl)-4,5-diethyl-6-methylhepta-2,4-dien-1-one (PubChem CID 130216715) has the molecular formula C25H44FNO and a molecular weight of 393.63 g/mol. Its IUPAC name is (2E,4E)-2-butan-2-yl-1-(4-butan-2-yl-4-fluoropiperidin-1-yl)-4,5-diethyl-6-methylhepta-2,4-dien-1-one.
| Compound Name | (2E,4E)-2-butan-2-yl-1-(4-butan-2-yl-4-fluoropiperidin-1-yl)-4,5-diethyl-6-methylhepta-2,4-dien-1-one |
|---|---|
| PubChem CID | 130216715 |
| Molecular Formula | C25H44FNO |
| Molecular Weight | 393.63 g/mol |
| Exact Mass | 393.34 |
| IUPAC Name | (2E,4E)-2-butan-2-yl-1-(4-butan-2-yl-4-fluoropiperidin-1-yl)-4,5-diethyl-6-methylhepta-2,4-dien-1-one |
| SMILES | CCC(/C=C(/C(=O)N1CCC(F)(C(C)CC)CC1)C(C)CC)=C(/CC)C(C)C |
| InChI | InChI=1S/C25H44FNO/c1-9-19(7)23(17-21(11-3)22(12-4)18(5)6)24(28)27-15-13-25(26,14-16-27)20(8)10-2/h17-20H,9-16H2,1-8H3/b22-21+,23-17+ |
| InChIKey | LHDXFGAOKACLTQ-CDFBMQFCSA-N |
| XLogP | 7.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|