C18H28FNO — CID 126551404
(E)-1-(4-fluoro-4-methylpiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one (PubChem CID 126551404) has the molecular formula C18H28FNO and a molecular weight of 293.43 g/mol. Its IUPAC name is (E)-1-(4-fluoro-4-methylpiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-fluoro-4-methylpiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126551404 |
| Molecular Formula | C18H28FNO |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (E)-1-(4-fluoro-4-methylpiperidin-1-yl)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-en-1-one |
| SMILES | CC1=C(/C=C/C(=O)N2CCC(C)(F)CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C18H28FNO/c1-14-6-5-9-17(2,3)15(14)7-8-16(21)20-12-10-18(4,19)11-13-20/h7-8H,5-6,9-13H2,1-4H3/b8-7+ |
| InChIKey | HDIPTAXEYKIARF-BQYQJAHWSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|