C19H30N4O6 — CID 144622419
(2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxo-3-piperazin-1-ylpyrrolidin-1-yl)butanoate;propane (PubChem CID 144622419) has the molecular formula C19H30N4O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxo-3-piperazin-1-ylpyrrolidin-1-yl)butanoate;propane.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxo-3-piperazin-1-ylpyrrolidin-1-yl)butanoate;propane |
|---|---|
| PubChem CID | 144622419 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-(2,5-dioxo-3-piperazin-1-ylpyrrolidin-1-yl)butanoate;propane |
| SMILES | CCC.O=C(CCCN1C(=O)CC(N2CCNCC2)C1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H22N4O6.C3H8/c21-12-3-4-13(22)20(12)26-15(24)2-1-7-19-14(23)10-11(16(19)25)18-8-5-17-6-9-18;1-3-2/h11,17H,1-10H2;3H2,1-2H3 |
| InChIKey | AXAAECUUTAMUDG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|