C15H26O2 — CID 14462326
2-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethoxy]oxane (PubChem CID 14462326) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethoxy]oxane.
| Compound Name | 2-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethoxy]oxane |
|---|---|
| PubChem CID | 14462326 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 2-[(2Z)-2-(3,3-dimethylcyclohexylidene)ethoxy]oxane |
| SMILES | CC1(C)CCC/C(=C/COC2CCCCO2)C1 |
| InChI | InChI=1S/C15H26O2/c1-15(2)9-5-6-13(12-15)8-11-17-14-7-3-4-10-16-14/h8,14H,3-7,9-12H2,1-2H3/b13-8- |
| InChIKey | KTCSPCYXNYKJGU-JYRVWZFOSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|