C25H42O2 — CID 134970831
2-[(E)-5-[(1S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enoxy]oxane (PubChem CID 134970831) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 2-[(E)-5-[(1S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enoxy]oxane.
| Compound Name | 2-[(E)-5-[(1S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enoxy]oxane |
|---|---|
| PubChem CID | 134970831 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 2-[(E)-5-[(1S,4aR)-1,2,5,5-tetramethyl-2,3,4,4a,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enoxy]oxane |
| SMILES | C/C(=C\COC1CCCCO1)CC[C@]1(C)C2=CCCC(C)(C)[C@H]2CCC1C |
| InChI | InChI=1S/C25H42O2/c1-19(14-18-27-23-10-6-7-17-26-23)13-16-25(5)20(2)11-12-21-22(25)9-8-15-24(21,3)4/h9,14,20-21,23H,6-8,10-13,15-18H2,1-5H3/b19-14+/t20?,21-,23?,25-/m0/s1 |
| InChIKey | ZYLDWOSDDMYRGO-HCYPIQRESA-N |
| XLogP | 7.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|