C26H44O2 — CID 71176563
(6S)-2-[[(2S,4aR,7S)-7-butyl-4a,7-dimethyl-2,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-yl]oxy]-6-methyloxane (PubChem CID 71176563) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is (6S)-2-[[(2S,4aR,7S)-7-butyl-4a,7-dimethyl-2,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-yl]oxy]-6-methyloxane.
| Compound Name | (6S)-2-[[(2S,4aR,7S)-7-butyl-4a,7-dimethyl-2,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-yl]oxy]-6-methyloxane |
|---|---|
| PubChem CID | 71176563 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | (6S)-2-[[(2S,4aR,7S)-7-butyl-4a,7-dimethyl-2,3,4,4b,5,6,8,8a,9,10-decahydrophenanthren-2-yl]oxy]-6-methyloxane |
| SMILES | CCCC[C@@]1(C)CCC2C(CCC3=C[C@@H](OC4CCC[C@H](C)O4)CC[C@@]32C)C1 |
| InChI | InChI=1S/C26H44O2/c1-5-6-14-25(3)15-13-23-20(18-25)10-11-21-17-22(12-16-26(21,23)4)28-24-9-7-8-19(2)27-24/h17,19-20,22-24H,5-16,18H2,1-4H3/t19-,20?,22-,23?,24?,25-,26-/m0/s1 |
| InChIKey | RUADSDCNFFCHST-HWSYBQGKSA-N |
| XLogP | 7.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|