C25H42O2 — CID 71176508
(6S)-2-[[(2S,4aR)-4a-methyl-5-[2-(1-methylcyclopentyl)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy]-6-methyloxane (PubChem CID 71176508) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (6S)-2-[[(2S,4aR)-4a-methyl-5-[2-(1-methylcyclopentyl)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy]-6-methyloxane.
| Compound Name | (6S)-2-[[(2S,4aR)-4a-methyl-5-[2-(1-methylcyclopentyl)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy]-6-methyloxane |
|---|---|
| PubChem CID | 71176508 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (6S)-2-[[(2S,4aR)-4a-methyl-5-[2-(1-methylcyclopentyl)ethyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy]-6-methyloxane |
| SMILES | C[C@H]1CCCC(O[C@@H]2C=C3CCCC(CCC4(C)CCCC4)[C@@]3(C)CC2)O1 |
| InChI | InChI=1S/C25H42O2/c1-19-8-6-11-23(26-19)27-22-13-17-25(3)20(9-7-10-21(25)18-22)12-16-24(2)14-4-5-15-24/h18-20,22-23H,4-17H2,1-3H3/t19-,20?,22-,23?,25+/m0/s1 |
| InChIKey | DCUDRBILAQAKEE-PKMJGHCFSA-N |
| XLogP | 7.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|