C25H40O3 — CID 143448349
(2R,4S,6S,7R,10R,14S)-4-ethenyl-10-ethoxy-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene (PubChem CID 143448349) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (2R,4S,6S,7R,10R,14S)-4-ethenyl-10-ethoxy-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene.
| Compound Name | (2R,4S,6S,7R,10R,14S)-4-ethenyl-10-ethoxy-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene |
|---|---|
| PubChem CID | 143448349 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (2R,4S,6S,7R,10R,14S)-4-ethenyl-10-ethoxy-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-ene |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)CC[C@@](C)(CC4C[C@H](OCC)CC[C@@]4(C)[C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C25H40O3/c1-8-19-27-21-20-16(3)10-12-24(6,23(20,4)5)15-17-14-18(26-9-2)11-13-25(17,7)22(21)28-19/h8,17-19,21-22H,1,9-15H2,2-7H3/t17?,18-,19-,21-,22-,24+,25-/m1/s1 |
| InChIKey | KUBPQKRCCLOFFP-USDSMDEZSA-N |
| XLogP | 6.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|