C24H36O3 — CID 147421381
(2R,4S,6S,7R,10R,13R,16S)-4-ethenyl-7,16,19,20,20-pentamethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene (PubChem CID 147421381) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (2R,4S,6S,7R,10R,13R,16S)-4-ethenyl-7,16,19,20,20-pentamethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene.
| Compound Name | (2R,4S,6S,7R,10R,13R,16S)-4-ethenyl-7,16,19,20,20-pentamethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene |
|---|---|
| PubChem CID | 147421381 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2R,4S,6S,7R,10R,13R,16S)-4-ethenyl-7,16,19,20,20-pentamethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)CC[C@@](C)(CC4[C@@H]5CO[C@@H]5CC[C@@]4(C)[C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C24H36O3/c1-7-18-26-20-19-14(2)8-10-23(5,22(19,3)4)12-16-15-13-25-17(15)9-11-24(16,6)21(20)27-18/h7,15-18,20-21H,1,8-13H2,2-6H3/t15-,16?,17+,18+,20+,21+,23-,24+/m0/s1 |
| InChIKey | DSNVGWUQKFEPON-JCETXNJYSA-N |
| XLogP | 5.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|